C31H26Cl2FN5O5 — CID 159287444
1-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]-4-fluoro-5-[(3R)-oxolan-3-yl]oxyphenyl]but-3-en-2-one (PubChem CID 159287444) has the molecular formula C31H26Cl2FN5O5 and a molecular weight of 638.48 g/mol. Its IUPAC name is 1-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]-4-fluoro-5-[(3R)-oxolan-3-yl]oxyphenyl]but-3-en-2-one.
| Compound Name | 1-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]-4-fluoro-5-[(3R)-oxolan-3-yl]oxyphenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 159287444 |
| Molecular Formula | C31H26Cl2FN5O5 |
| Molecular Weight | 638.48 g/mol |
| Exact Mass | 637.13 |
| IUPAC Name | 1-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]-4-fluoro-5-[(3R)-oxolan-3-yl]oxyphenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cc(O[C@@H]2CCOC2)c(F)cc1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)c3nccn3c2n1 |
| InChI | InChI=1S/C31H26Cl2FN5O5/c1-4-18(40)9-16-11-23(44-19-5-8-43-15-19)21(34)12-22(16)37-31-36-14-17-10-20(30-35-6-7-39(30)29(17)38-31)26-27(32)24(41-2)13-25(42-3)28(26)33/h4,6-7,10-14,19H,1,5,8-9,15H2,2-3H3,(H,36,37,38)/t19-/m1/s1 |
| InChIKey | KZRNUDCWHUFQFF-LJQANCHMSA-N |
| XLogP | 6.62 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.48 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|