C28H30Cl2N6O3 — CID 155259850
1-[3-[3-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-12-(methylamino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 155259850) has the molecular formula C28H30Cl2N6O3 and a molecular weight of 569.49 g/mol. Its IUPAC name is 1-[3-[3-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-12-(methylamino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[3-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-12-(methylamino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155259850 |
| Molecular Formula | C28H30Cl2N6O3 |
| Molecular Weight | 569.49 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | 1-[3-[3-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-12-(methylamino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(CCCc2cn3c(n2)c(-c2c(Cl)c(OC)cc(OC)c2Cl)cc2cnc(NC)nc23)C1 |
| InChI | InChI=1S/C28H30Cl2N6O3/c1-5-22(37)35-10-9-16(14-35)7-6-8-18-15-36-26-17(13-32-28(31-2)34-26)11-19(27(36)33-18)23-24(29)20(38-3)12-21(39-4)25(23)30/h5,11-13,15-16H,1,6-10,14H2,2-4H3,(H,31,32,34) |
| InChIKey | GJSROGZLRDLLOU-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.49 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|