C33H41Cl2N7 — CID 155108652
4-[3-(4-buta-1,3-dien-2-yl-3,3-dimethylpiperazin-1-yl)propyl]-7-(2,6-dichloro-3,5-diethylphenyl)-N-methyl-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine (PubChem CID 155108652) has the molecular formula C33H41Cl2N7 and a molecular weight of 606.65 g/mol. Its IUPAC name is 4-[3-(4-buta-1,3-dien-2-yl-3,3-dimethylpiperazin-1-yl)propyl]-7-(2,6-dichloro-3,5-diethylphenyl)-N-methyl-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine.
| Compound Name | 4-[3-(4-buta-1,3-dien-2-yl-3,3-dimethylpiperazin-1-yl)propyl]-7-(2,6-dichloro-3,5-diethylphenyl)-N-methyl-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine |
|---|---|
| PubChem CID | 155108652 |
| Molecular Formula | C33H41Cl2N7 |
| Molecular Weight | 606.65 g/mol |
| Exact Mass | 605.28 |
| IUPAC Name | 4-[3-(4-buta-1,3-dien-2-yl-3,3-dimethylpiperazin-1-yl)propyl]-7-(2,6-dichloro-3,5-diethylphenyl)-N-methyl-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine |
| SMILES | C=CC(=C)N1CCN(CCCc2cn3c(n2)c(-c2c(Cl)c(CC)cc(CC)c2Cl)cc2cnc(NC)nc23)CC1(C)C |
| InChI | InChI=1S/C33H41Cl2N7/c1-8-21(4)42-15-14-40(20-33(42,5)6)13-11-12-25-19-41-30-24(18-37-32(36-7)39-30)17-26(31(41)38-25)27-28(34)22(9-2)16-23(10-3)29(27)35/h8,16-19H,1,4,9-15,20H2,2-3,5-7H3,(H,36,37,39) |
| InChIKey | OUNUCJPXCAKJHB-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 61.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.65 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|