C24H18Cl2N6O4 — CID 155633789
7-(2,6-dichloro-3,5-dimethoxyphenyl)-N-methyl-4-(4-nitrophenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine (PubChem CID 155633789) has the molecular formula C24H18Cl2N6O4 and a molecular weight of 525.35 g/mol. Its IUPAC name is 7-(2,6-dichloro-3,5-dimethoxyphenyl)-N-methyl-4-(4-nitrophenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine.
| Compound Name | 7-(2,6-dichloro-3,5-dimethoxyphenyl)-N-methyl-4-(4-nitrophenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine |
|---|---|
| PubChem CID | 155633789 |
| Molecular Formula | C24H18Cl2N6O4 |
| Molecular Weight | 525.35 g/mol |
| Exact Mass | 524.08 |
| IUPAC Name | 7-(2,6-dichloro-3,5-dimethoxyphenyl)-N-methyl-4-(4-nitrophenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine |
| SMILES | CNc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)c3nc(-c4ccc([N+](=O)[O-])cc4)cn3c2n1 |
| InChI | InChI=1S/C24H18Cl2N6O4/c1-27-24-28-10-13-8-15(19-20(25)17(35-2)9-18(36-3)21(19)26)23-29-16(11-31(23)22(13)30-24)12-4-6-14(7-5-12)32(33)34/h4-11H,1-3H3,(H,27,28,30) |
| InChIKey | BVUYHENQINXKSM-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.35 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|