C25H27ClN8O3 — CID 150072575
1-[4-[[7-(2-chloro-3,5-dimethoxyphenyl)-12-(methylamino)-2,3,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]methyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 150072575) has the molecular formula C25H27ClN8O3 and a molecular weight of 523.00 g/mol. Its IUPAC name is 1-[4-[[7-(2-chloro-3,5-dimethoxyphenyl)-12-(methylamino)-2,3,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]methyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[[7-(2-chloro-3,5-dimethoxyphenyl)-12-(methylamino)-2,3,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]methyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 150072575 |
| Molecular Formula | C25H27ClN8O3 |
| Molecular Weight | 523.00 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 1-[4-[[7-(2-chloro-3,5-dimethoxyphenyl)-12-(methylamino)-2,3,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]methyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(Cc2nc3c(-c4cc(OC)cc(OC)c4Cl)cc4cnc(NC)nc4n3n2)CC1 |
| InChI | InChI=1S/C25H27ClN8O3/c1-5-21(35)33-8-6-32(7-9-33)14-20-29-24-18(17-11-16(36-3)12-19(37-4)22(17)26)10-15-13-28-25(27-2)30-23(15)34(24)31-20/h5,10-13H,1,6-9,14H2,2-4H3,(H,27,28,30) |
| InChIKey | DPOYOIDRJBOYAM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.00 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|