C30H27Cl2N7O3 — CID 138599301
N-[3-[7-[2,6-dichloro-3-methoxy-5-(methylamino)phenyl]-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]-5-morpholin-4-ylphenyl]prop-2-enamide (PubChem CID 138599301) has the molecular formula C30H27Cl2N7O3 and a molecular weight of 604.50 g/mol. Its IUPAC name is N-[3-[7-[2,6-dichloro-3-methoxy-5-(methylamino)phenyl]-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]-5-morpholin-4-ylphenyl]prop-2-enamide.
| Compound Name | N-[3-[7-[2,6-dichloro-3-methoxy-5-(methylamino)phenyl]-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]-5-morpholin-4-ylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 138599301 |
| Molecular Formula | C30H27Cl2N7O3 |
| Molecular Weight | 604.50 g/mol |
| Exact Mass | 603.16 |
| IUPAC Name | N-[3-[7-[2,6-dichloro-3-methoxy-5-(methylamino)phenyl]-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]-5-morpholin-4-ylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2ncc3cc(-c4c(Cl)c(NC)cc(OC)c4Cl)c4nccn4c3n2)cc(N2CCOCC2)c1 |
| InChI | InChI=1S/C30H27Cl2N7O3/c1-4-24(40)36-19-11-17(12-20(14-19)38-7-9-42-10-8-38)28-35-16-18-13-21(30-34-5-6-39(30)29(18)37-28)25-26(31)22(33-2)15-23(41-3)27(25)32/h4-6,11-16,33H,1,7-10H2,2-3H3,(H,36,40) |
| InChIKey | FOFKITDUBODHES-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.50 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|