C19H18Cl2N4O2S — CID 160894475
2,4-dichloro-5-methoxy-3-(12-methylsulfanyl-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-7-yl)phenol;ethane (PubChem CID 160894475) has the molecular formula C19H18Cl2N4O2S and a molecular weight of 437.35 g/mol. Its IUPAC name is 2,4-dichloro-5-methoxy-3-(12-methylsulfanyl-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-7-yl)phenol;ethane.
| Compound Name | 2,4-dichloro-5-methoxy-3-(12-methylsulfanyl-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-7-yl)phenol;ethane |
|---|---|
| PubChem CID | 160894475 |
| Molecular Formula | C19H18Cl2N4O2S |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 2,4-dichloro-5-methoxy-3-(12-methylsulfanyl-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-7-yl)phenol;ethane |
| SMILES | CC.COc1cc(O)c(Cl)c(-c2cc3cnc(SC)nc3n3ccnc23)c1Cl |
| InChI | InChI=1S/C17H12Cl2N4O2S.C2H6/c1-25-11-6-10(24)13(18)12(14(11)19)9-5-8-7-21-17(26-2)22-15(8)23-4-3-20-16(9)23;1-2/h3-7,24H,1-2H3;1-2H3 |
| InChIKey | SOROSPNLFSQZGP-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 72.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |