C19H23N5O4 — CID 121451931
2-methoxy-N-[4-(3-morpholin-4-ylazetidin-1-yl)phenyl]-5-nitropyridin-4-amine (PubChem CID 121451931) has the molecular formula C19H23N5O4 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-methoxy-N-[4-(3-morpholin-4-ylazetidin-1-yl)phenyl]-5-nitropyridin-4-amine.
| Compound Name | 2-methoxy-N-[4-(3-morpholin-4-ylazetidin-1-yl)phenyl]-5-nitropyridin-4-amine |
|---|---|
| PubChem CID | 121451931 |
| Molecular Formula | C19H23N5O4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 2-methoxy-N-[4-(3-morpholin-4-ylazetidin-1-yl)phenyl]-5-nitropyridin-4-amine |
| SMILES | COc1cc(Nc2ccc(N3CC(N4CCOCC4)C3)cc2)c([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C19H23N5O4/c1-27-19-10-17(18(11-20-19)24(25)26)21-14-2-4-15(5-3-14)23-12-16(13-23)22-6-8-28-9-7-22/h2-5,10-11,16H,6-9,12-13H2,1H3,(H,20,21) |
| InChIKey | FTCTZXIJCJXJRW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 93.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|