C21H20N4O2 — CID 25018564
6-ethynyl-7-methoxy-N-(4-morpholin-4-ylphenyl)quinazolin-2-amine (PubChem CID 25018564) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 6-ethynyl-7-methoxy-N-(4-morpholin-4-ylphenyl)quinazolin-2-amine.
| Compound Name | 6-ethynyl-7-methoxy-N-(4-morpholin-4-ylphenyl)quinazolin-2-amine |
|---|---|
| PubChem CID | 25018564 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 6-ethynyl-7-methoxy-N-(4-morpholin-4-ylphenyl)quinazolin-2-amine |
| SMILES | C#Cc1cc2cnc(Nc3ccc(N4CCOCC4)cc3)nc2cc1OC |
| InChI | InChI=1S/C21H20N4O2/c1-3-15-12-16-14-22-21(24-19(16)13-20(15)26-2)23-17-4-6-18(7-5-17)25-8-10-27-11-9-25/h1,4-7,12-14H,8-11H2,2H3,(H,22,23,24) |
| InChIKey | LPTAGLGITWCTDL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|