C26H27N5O3 — CID 88954305
[4-[(6-ethynyl-7-piperidin-4-yloxyquinazolin-2-yl)amino]phenyl]-morpholin-4-ylmethanone (PubChem CID 88954305) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is [4-[(6-ethynyl-7-piperidin-4-yloxyquinazolin-2-yl)amino]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[(6-ethynyl-7-piperidin-4-yloxyquinazolin-2-yl)amino]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 88954305 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | [4-[(6-ethynyl-7-piperidin-4-yloxyquinazolin-2-yl)amino]phenyl]-morpholin-4-ylmethanone |
| SMILES | C#Cc1cc2cnc(Nc3ccc(C(=O)N4CCOCC4)cc3)nc2cc1OC1CCNCC1 |
| InChI | InChI=1S/C26H27N5O3/c1-2-18-15-20-17-28-26(30-23(20)16-24(18)34-22-7-9-27-10-8-22)29-21-5-3-19(4-6-21)25(32)31-11-13-33-14-12-31/h1,3-6,15-17,22,27H,7-14H2,(H,28,29,30) |
| InChIKey | KVSNVQGJCMJLDU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|