C28H30N6O3 — CID 145052839
1-[4-[4-[[4-[3-ethynyl-4-(oxan-4-yloxy)phenyl]-1,3,5-triazin-2-yl]amino]phenyl]piperazin-1-yl]ethanone (PubChem CID 145052839) has the molecular formula C28H30N6O3 and a molecular weight of 498.59 g/mol. Its IUPAC name is 1-[4-[4-[[4-[3-ethynyl-4-(oxan-4-yloxy)phenyl]-1,3,5-triazin-2-yl]amino]phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[4-[[4-[3-ethynyl-4-(oxan-4-yloxy)phenyl]-1,3,5-triazin-2-yl]amino]phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 145052839 |
| Molecular Formula | C28H30N6O3 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 1-[4-[4-[[4-[3-ethynyl-4-(oxan-4-yloxy)phenyl]-1,3,5-triazin-2-yl]amino]phenyl]piperazin-1-yl]ethanone |
| SMILES | C#Cc1cc(-c2ncnc(Nc3ccc(N4CCN(C(C)=O)CC4)cc3)n2)ccc1OC1CCOCC1 |
| InChI | InChI=1S/C28H30N6O3/c1-3-21-18-22(4-9-26(21)37-25-10-16-36-17-11-25)27-29-19-30-28(32-27)31-23-5-7-24(8-6-23)34-14-12-33(13-15-34)20(2)35/h1,4-9,18-19,25H,10-17H2,2H3,(H,29,30,31,32) |
| InChIKey | DUXOGRSVQOKFSV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|