C27H28FN7O4 — CID 139353667
2-[(3R,4S)-3-fluoro-1-(2-hydroxyacetyl)piperidin-4-yl]oxy-5-[4-(4-morpholin-4-ylanilino)-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 139353667) has the molecular formula C27H28FN7O4 and a molecular weight of 533.56 g/mol. Its IUPAC name is 2-[(3R,4S)-3-fluoro-1-(2-hydroxyacetyl)piperidin-4-yl]oxy-5-[4-(4-morpholin-4-ylanilino)-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-[(3R,4S)-3-fluoro-1-(2-hydroxyacetyl)piperidin-4-yl]oxy-5-[4-(4-morpholin-4-ylanilino)-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 139353667 |
| Molecular Formula | C27H28FN7O4 |
| Molecular Weight | 533.56 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | 2-[(3R,4S)-3-fluoro-1-(2-hydroxyacetyl)piperidin-4-yl]oxy-5-[4-(4-morpholin-4-ylanilino)-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | N#Cc1cc(-c2ncnc(Nc3ccc(N4CCOCC4)cc3)n2)ccc1O[C@H]1CCN(C(=O)CO)C[C@H]1F |
| InChI | InChI=1S/C27H28FN7O4/c28-22-15-35(25(37)16-36)8-7-24(22)39-23-6-1-18(13-19(23)14-29)26-30-17-31-27(33-26)32-20-2-4-21(5-3-20)34-9-11-38-12-10-34/h1-6,13,17,22,24,36H,7-12,15-16H2,(H,30,31,32,33)/t22-,24+/m1/s1 |
| InChIKey | HKYFITOORZDKCJ-VWNXMTODSA-N |
| XLogP | 2.30 |
| TPSA | 136.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.56 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|