C31H35FN8O5 — CID 118979889
2-[(3S,4S)-1-[(2R)-2,3-dihydroxypropanoyl]-3-fluoropiperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 118979889) has the molecular formula C31H35FN8O5 and a molecular weight of 618.67 g/mol. Its IUPAC name is 2-[(3S,4S)-1-[(2R)-2,3-dihydroxypropanoyl]-3-fluoropiperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-[(3S,4S)-1-[(2R)-2,3-dihydroxypropanoyl]-3-fluoropiperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 118979889 |
| Molecular Formula | C31H35FN8O5 |
| Molecular Weight | 618.67 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | 2-[(3S,4S)-1-[(2R)-2,3-dihydroxypropanoyl]-3-fluoropiperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | N#Cc1cc(-c2ncnc(Nc3ccc(N4CCN(C5COC5)CC4)cc3)n2)ccc1O[C@H]1CCN(C(=O)[C@H](O)CO)C[C@@H]1F |
| InChI | InChI=1S/C31H35FN8O5/c32-25-15-40(30(43)26(42)16-41)8-7-28(25)45-27-6-1-20(13-21(27)14-33)29-34-19-35-31(37-29)36-22-2-4-23(5-3-22)38-9-11-39(12-10-38)24-17-44-18-24/h1-6,13,19,24-26,28,41-42H,7-12,15-18H2,(H,34,35,36,37)/t25-,26+,28-/m0/s1 |
| InChIKey | GKJOCWMFOAWFSA-REUBFRLUSA-N |
| XLogP | 1.35 |
| TPSA | 160.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.67 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|