C32H38FN9O4 — CID 145052545
(3R)-4-[2-cyano-4-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]phenoxy]-3-fluoro-N-(2-methoxyethyl)piperidine-1-carboxamide (PubChem CID 145052545) has the molecular formula C32H38FN9O4 and a molecular weight of 631.71 g/mol. Its IUPAC name is (3R)-4-[2-cyano-4-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]phenoxy]-3-fluoro-N-(2-methoxyethyl)piperidine-1-carboxamide.
| Compound Name | (3R)-4-[2-cyano-4-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]phenoxy]-3-fluoro-N-(2-methoxyethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 145052545 |
| Molecular Formula | C32H38FN9O4 |
| Molecular Weight | 631.71 g/mol |
| Exact Mass | 631.30 |
| IUPAC Name | (3R)-4-[2-cyano-4-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]phenoxy]-3-fluoro-N-(2-methoxyethyl)piperidine-1-carboxamide |
| SMILES | COCCNC(=O)N1CCC(Oc2ccc(-c3ncnc(Nc4ccc(N5CCN(C6COC6)CC5)cc4)n3)cc2C#N)[C@H](F)C1 |
| InChI | InChI=1S/C32H38FN9O4/c1-44-15-9-35-32(43)42-10-8-29(27(33)18-42)46-28-7-2-22(16-23(28)17-34)30-36-21-37-31(39-30)38-24-3-5-25(6-4-24)40-11-13-41(14-12-40)26-19-45-20-26/h2-7,16,21,26-27,29H,8-15,18-20H2,1H3,(H,35,43)(H,36,37,38,39)/t27-,29?/m1/s1 |
| InChIKey | FSMHXZZFIBIERO-SCBLGKRXSA-N |
| XLogP | 2.82 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.71 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|