C32H34FN11O3 — CID 118980020
2-[(3R,4S)-3-fluoro-1-(5-methyl-1H-1,2,4-triazole-3-carbonyl)piperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 118980020) has the molecular formula C32H34FN11O3 and a molecular weight of 639.70 g/mol. Its IUPAC name is 2-[(3R,4S)-3-fluoro-1-(5-methyl-1H-1,2,4-triazole-3-carbonyl)piperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-[(3R,4S)-3-fluoro-1-(5-methyl-1H-1,2,4-triazole-3-carbonyl)piperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 118980020 |
| Molecular Formula | C32H34FN11O3 |
| Molecular Weight | 639.70 g/mol |
| Exact Mass | 639.28 |
| IUPAC Name | 2-[(3R,4S)-3-fluoro-1-(5-methyl-1H-1,2,4-triazole-3-carbonyl)piperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | Cc1nc(C(=O)N2CC[C@H](Oc3ccc(-c4ncnc(Nc5ccc(N6CCN(C7COC7)CC6)cc5)n4)cc3C#N)[C@H](F)C2)n[nH]1 |
| InChI | InChI=1S/C32H34FN11O3/c1-20-37-30(41-40-20)31(45)44-9-8-28(26(33)16-44)47-27-7-2-21(14-22(27)15-34)29-35-19-36-32(39-29)38-23-3-5-24(6-4-23)42-10-12-43(13-11-42)25-17-46-18-25/h2-7,14,19,25-26,28H,8-13,16-18H2,1H3,(H,37,40,41)(H,35,36,38,39)/t26-,28+/m1/s1 |
| InChIKey | KFFKOAOSWSOFIH-IAPPQJPRSA-N |
| XLogP | 2.73 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.70 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|