C33H36FN9O4 — CID 118979941
2-[(3R,4S)-3-fluoro-1-(2-oxopyrrolidine-3-carbonyl)piperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 118979941) has the molecular formula C33H36FN9O4 and a molecular weight of 641.71 g/mol. Its IUPAC name is 2-[(3R,4S)-3-fluoro-1-(2-oxopyrrolidine-3-carbonyl)piperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-[(3R,4S)-3-fluoro-1-(2-oxopyrrolidine-3-carbonyl)piperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 118979941 |
| Molecular Formula | C33H36FN9O4 |
| Molecular Weight | 641.71 g/mol |
| Exact Mass | 641.29 |
| IUPAC Name | 2-[(3R,4S)-3-fluoro-1-(2-oxopyrrolidine-3-carbonyl)piperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | N#Cc1cc(-c2ncnc(Nc3ccc(N4CCN(C5COC5)CC4)cc3)n2)ccc1O[C@H]1CCN(C(=O)C2CCNC2=O)C[C@H]1F |
| InChI | InChI=1S/C33H36FN9O4/c34-27-17-43(32(45)26-7-9-36-31(26)44)10-8-29(27)47-28-6-1-21(15-22(28)16-35)30-37-20-38-33(40-30)39-23-2-4-24(5-3-23)41-11-13-42(14-12-41)25-18-46-19-25/h1-6,15,20,25-27,29H,7-14,17-19H2,(H,36,44)(H,37,38,39,40)/t26?,27-,29+/m1/s1 |
| InChIKey | BRFDVBCXJGJSLT-OCDUHGDJSA-N |
| XLogP | 2.13 |
| TPSA | 148.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.71 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|