C34H36F2N8O4 — CID 149226539
2-[(3R,4S)-3-fluoro-1-[(1S,3S)-3-fluoro-4-oxocyclopentanecarbonyl]piperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 149226539) has the molecular formula C34H36F2N8O4 and a molecular weight of 658.71 g/mol. Its IUPAC name is 2-[(3R,4S)-3-fluoro-1-[(1S,3S)-3-fluoro-4-oxocyclopentanecarbonyl]piperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-[(3R,4S)-3-fluoro-1-[(1S,3S)-3-fluoro-4-oxocyclopentanecarbonyl]piperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 149226539 |
| Molecular Formula | C34H36F2N8O4 |
| Molecular Weight | 658.71 g/mol |
| Exact Mass | 658.28 |
| IUPAC Name | 2-[(3R,4S)-3-fluoro-1-[(1S,3S)-3-fluoro-4-oxocyclopentanecarbonyl]piperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | N#Cc1cc(-c2ncnc(Nc3ccc(N4CCN(C5COC5)CC4)cc3)n2)ccc1O[C@H]1CCN(C(=O)[C@H]2CC(=O)[C@@H](F)C2)C[C@H]1F |
| InChI | InChI=1S/C34H36F2N8O4/c35-27-14-22(15-29(27)45)33(46)44-8-7-31(28(36)17-44)48-30-6-1-21(13-23(30)16-37)32-38-20-39-34(41-32)40-24-2-4-25(5-3-24)42-9-11-43(12-10-42)26-18-47-19-26/h1-6,13,20,22,26-28,31H,7-12,14-15,17-19H2,(H,38,39,40,41)/t22-,27+,28-,31+/m1/s1 |
| InChIKey | XJLZFIKDEFIFRQ-HGMGHHOWSA-N |
| XLogP | 3.31 |
| TPSA | 136.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.71 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|