C34H37FN10O3 — CID 118980572
2-[(3R,4S)-1-(4,5-dimethyl-1H-pyrazole-3-carbonyl)-3-fluoropiperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 118980572) has the molecular formula C34H37FN10O3 and a molecular weight of 652.74 g/mol. Its IUPAC name is 2-[(3R,4S)-1-(4,5-dimethyl-1H-pyrazole-3-carbonyl)-3-fluoropiperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-[(3R,4S)-1-(4,5-dimethyl-1H-pyrazole-3-carbonyl)-3-fluoropiperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 118980572 |
| Molecular Formula | C34H37FN10O3 |
| Molecular Weight | 652.74 g/mol |
| Exact Mass | 652.30 |
| IUPAC Name | 2-[(3R,4S)-1-(4,5-dimethyl-1H-pyrazole-3-carbonyl)-3-fluoropiperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | Cc1[nH]nc(C(=O)N2CC[C@H](Oc3ccc(-c4ncnc(Nc5ccc(N6CCN(C7COC7)CC6)cc5)n4)cc3C#N)[C@H](F)C2)c1C |
| InChI | InChI=1S/C34H37FN10O3/c1-21-22(2)41-42-31(21)33(46)45-10-9-30(28(35)17-45)48-29-8-3-23(15-24(29)16-36)32-37-20-38-34(40-32)39-25-4-6-26(7-5-25)43-11-13-44(14-12-43)27-18-47-19-27/h3-8,15,20,27-28,30H,9-14,17-19H2,1-2H3,(H,41,42)(H,37,38,39,40)/t28-,30+/m1/s1 |
| InChIKey | UTOHGHJVUZYLKD-DGPALRBDSA-N |
| XLogP | 3.65 |
| TPSA | 148.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.74 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|