C30H36N8O2 — CID 145052584
2-(1-methylazepan-4-yl)oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 145052584) has the molecular formula C30H36N8O2 and a molecular weight of 540.67 g/mol. Its IUPAC name is 2-(1-methylazepan-4-yl)oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-(1-methylazepan-4-yl)oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 145052584 |
| Molecular Formula | C30H36N8O2 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | 2-(1-methylazepan-4-yl)oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | CN1CCCC(Oc2ccc(-c3ncnc(Nc4ccc(N5CCN(C6COC6)CC5)cc4)n3)cc2C#N)CC1 |
| InChI | InChI=1S/C30H36N8O2/c1-36-11-2-3-27(10-12-36)40-28-9-4-22(17-23(28)18-31)29-32-21-33-30(35-29)34-24-5-7-25(8-6-24)37-13-15-38(16-14-37)26-19-39-20-26/h4-9,17,21,26-27H,2-3,10-16,19-20H2,1H3,(H,32,33,34,35) |
| InChIKey | QNCRWBUCKINBRF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|