C29H31FN8O3 — CID 139353907
2-(3-fluoro-1-formylpiperidin-4-yl)oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 139353907) has the molecular formula C29H31FN8O3 and a molecular weight of 558.62 g/mol. Its IUPAC name is 2-(3-fluoro-1-formylpiperidin-4-yl)oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-(3-fluoro-1-formylpiperidin-4-yl)oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 139353907 |
| Molecular Formula | C29H31FN8O3 |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | 2-(3-fluoro-1-formylpiperidin-4-yl)oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | N#Cc1cc(-c2ncnc(Nc3ccc(N4CCN(C5COC5)CC4)cc3)n2)ccc1OC1CCN(C=O)CC1F |
| InChI | InChI=1S/C29H31FN8O3/c30-25-15-36(19-39)8-7-27(25)41-26-6-1-20(13-21(26)14-31)28-32-18-33-29(35-28)34-22-2-4-23(5-3-22)37-9-11-38(12-10-37)24-16-40-17-24/h1-6,13,18-19,24-25,27H,7-12,15-17H2,(H,32,33,34,35) |
| InChIKey | STDHGNMXDNMGFG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|