C30H34F2N8O2 — CID 139354000
2-(4,4-difluoroazocan-5-yl)oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 139354000) has the molecular formula C30H34F2N8O2 and a molecular weight of 576.65 g/mol. Its IUPAC name is 2-(4,4-difluoroazocan-5-yl)oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-(4,4-difluoroazocan-5-yl)oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 139354000 |
| Molecular Formula | C30H34F2N8O2 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.28 |
| IUPAC Name | 2-(4,4-difluoroazocan-5-yl)oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | N#Cc1cc(-c2ncnc(Nc3ccc(N4CCN(C5COC5)CC4)cc3)n2)ccc1OC1CCCNCCC1(F)F |
| InChI | InChI=1S/C30H34F2N8O2/c31-30(32)9-11-34-10-1-2-27(30)42-26-8-3-21(16-22(26)17-33)28-35-20-36-29(38-28)37-23-4-6-24(7-5-23)39-12-14-40(15-13-39)25-18-41-19-25/h3-8,16,20,25,27,34H,1-2,9-15,18-19H2,(H,35,36,37,38) |
| InChIKey | ZXEOTWFDFAMBOU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 111.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|