C27H28FN7O3 — CID 118980242
2-[(3-fluorooxetan-3-yl)methoxy]-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 118980242) has the molecular formula C27H28FN7O3 and a molecular weight of 517.57 g/mol. Its IUPAC name is 2-[(3-fluorooxetan-3-yl)methoxy]-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-[(3-fluorooxetan-3-yl)methoxy]-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 118980242 |
| Molecular Formula | C27H28FN7O3 |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | 2-[(3-fluorooxetan-3-yl)methoxy]-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | N#Cc1cc(-c2ncnc(Nc3ccc(N4CCN(C5COC5)CC4)cc3)n2)ccc1OCC1(F)COC1 |
| InChI | InChI=1S/C27H28FN7O3/c28-27(15-37-16-27)17-38-24-6-1-19(11-20(24)12-29)25-30-18-31-26(33-25)32-21-2-4-22(5-3-21)34-7-9-35(10-8-34)23-13-36-14-23/h1-6,11,18,23H,7-10,13-17H2,(H,30,31,32,33) |
| InChIKey | BNYOMOHLQOUMQI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 108.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|