C26H25F3N8O2 — CID 121247013
N-[2-cyano-4-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]phenyl]-3,3,3-trifluoropropanamide (PubChem CID 121247013) has the molecular formula C26H25F3N8O2 and a molecular weight of 538.53 g/mol. Its IUPAC name is N-[2-cyano-4-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]phenyl]-3,3,3-trifluoropropanamide.
| Compound Name | N-[2-cyano-4-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]phenyl]-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 121247013 |
| Molecular Formula | C26H25F3N8O2 |
| Molecular Weight | 538.53 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | N-[2-cyano-4-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]phenyl]-3,3,3-trifluoropropanamide |
| SMILES | N#Cc1cc(-c2ncnc(Nc3ccc(N4CCN(C5COC5)CC4)cc3)n2)ccc1NC(=O)CC(F)(F)F |
| InChI | InChI=1S/C26H25F3N8O2/c27-26(28,29)12-23(38)34-22-6-1-17(11-18(22)13-30)24-31-16-32-25(35-24)33-19-2-4-20(5-3-19)36-7-9-37(10-8-36)21-14-39-15-21/h1-6,11,16,21H,7-10,12,14-15H2,(H,34,38)(H,31,32,33,35) |
| InChIKey | HRMPJJSTJWUUBG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|