C25H27N7O2 — CID 139353596
N-[2-cyano-4-[4-(4-morpholin-4-ylanilino)-1,3,5-triazin-2-yl]phenyl]pentanamide (PubChem CID 139353596) has the molecular formula C25H27N7O2 and a molecular weight of 457.54 g/mol. Its IUPAC name is N-[2-cyano-4-[4-(4-morpholin-4-ylanilino)-1,3,5-triazin-2-yl]phenyl]pentanamide.
| Compound Name | N-[2-cyano-4-[4-(4-morpholin-4-ylanilino)-1,3,5-triazin-2-yl]phenyl]pentanamide |
|---|---|
| PubChem CID | 139353596 |
| Molecular Formula | C25H27N7O2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | N-[2-cyano-4-[4-(4-morpholin-4-ylanilino)-1,3,5-triazin-2-yl]phenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(-c2ncnc(Nc3ccc(N4CCOCC4)cc3)n2)cc1C#N |
| InChI | InChI=1S/C25H27N7O2/c1-2-3-4-23(33)30-22-10-5-18(15-19(22)16-26)24-27-17-28-25(31-24)29-20-6-8-21(9-7-20)32-11-13-34-14-12-32/h5-10,15,17H,2-4,11-14H2,1H3,(H,30,33)(H,27,28,29,31) |
| InChIKey | QCDAZEKIHAFTGS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|