C25H26N6O4S — CID 118978881
5-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-1,3,5-triazin-2-yl]-2-(oxan-4-yloxy)benzonitrile (PubChem CID 118978881) has the molecular formula C25H26N6O4S and a molecular weight of 506.59 g/mol. Its IUPAC name is 5-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-1,3,5-triazin-2-yl]-2-(oxan-4-yloxy)benzonitrile.
| Compound Name | 5-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-1,3,5-triazin-2-yl]-2-(oxan-4-yloxy)benzonitrile |
|---|---|
| PubChem CID | 118978881 |
| Molecular Formula | C25H26N6O4S |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 5-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-1,3,5-triazin-2-yl]-2-(oxan-4-yloxy)benzonitrile |
| SMILES | N#Cc1cc(-c2ncnc(Nc3ccc(N4CCS(=O)(=O)CC4)cc3)n2)ccc1OC1CCOCC1 |
| InChI | InChI=1S/C25H26N6O4S/c26-16-19-15-18(1-6-23(19)35-22-7-11-34-12-8-22)24-27-17-28-25(30-24)29-20-2-4-21(5-3-20)31-9-13-36(32,33)14-10-31/h1-6,15,17,22H,7-14H2,(H,27,28,29,30) |
| InChIKey | WEIINZDVEDDFAB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|