C25H26N6O3 — CID 118979166
5-[4-(3-morpholin-4-ylanilino)-1,3,5-triazin-2-yl]-2-(oxan-4-yloxy)benzonitrile (PubChem CID 118979166) has the molecular formula C25H26N6O3 and a molecular weight of 458.52 g/mol. Its IUPAC name is 5-[4-(3-morpholin-4-ylanilino)-1,3,5-triazin-2-yl]-2-(oxan-4-yloxy)benzonitrile.
| Compound Name | 5-[4-(3-morpholin-4-ylanilino)-1,3,5-triazin-2-yl]-2-(oxan-4-yloxy)benzonitrile |
|---|---|
| PubChem CID | 118979166 |
| Molecular Formula | C25H26N6O3 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 5-[4-(3-morpholin-4-ylanilino)-1,3,5-triazin-2-yl]-2-(oxan-4-yloxy)benzonitrile |
| SMILES | N#Cc1cc(-c2ncnc(Nc3cccc(N4CCOCC4)c3)n2)ccc1OC1CCOCC1 |
| InChI | InChI=1S/C25H26N6O3/c26-16-19-14-18(4-5-23(19)34-22-6-10-32-11-7-22)24-27-17-28-25(30-24)29-20-2-1-3-21(15-20)31-8-12-33-13-9-31/h1-5,14-15,17,22H,6-13H2,(H,27,28,29,30) |
| InChIKey | AYYWOVUIQSBYDE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |