C28H30N8O3 — CID 118979206
5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]-2-[(3S)-6-oxopiperidin-3-yl]oxybenzonitrile (PubChem CID 118979206) has the molecular formula C28H30N8O3 and a molecular weight of 526.60 g/mol. Its IUPAC name is 5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]-2-[(3S)-6-oxopiperidin-3-yl]oxybenzonitrile.
| Compound Name | 5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]-2-[(3S)-6-oxopiperidin-3-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 118979206 |
| Molecular Formula | C28H30N8O3 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | 5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]-2-[(3S)-6-oxopiperidin-3-yl]oxybenzonitrile |
| SMILES | N#Cc1cc(-c2ncnc(Nc3ccc(N4CCN(C5COC5)CC4)cc3)n2)ccc1O[C@H]1CCC(=O)NC1 |
| InChI | InChI=1S/C28H30N8O3/c29-14-20-13-19(1-7-25(20)39-24-6-8-26(37)30-15-24)27-31-18-32-28(34-27)33-21-2-4-22(5-3-21)35-9-11-36(12-10-35)23-16-38-17-23/h1-5,7,13,18,23-24H,6,8-12,15-17H2,(H,30,37)(H,31,32,33,34)/t24-/m0/s1 |
| InChIKey | DIXDYWHMSFOQRD-DEOSSOPVSA-N |
| XLogP | 2.33 |
| TPSA | 128.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|