C29H32N8O4 — CID 118980322
5-[4-[3-methoxy-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]-2-(6-oxopiperidin-3-yl)oxybenzonitrile (PubChem CID 118980322) has the molecular formula C29H32N8O4 and a molecular weight of 556.63 g/mol. Its IUPAC name is 5-[4-[3-methoxy-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]-2-(6-oxopiperidin-3-yl)oxybenzonitrile.
| Compound Name | 5-[4-[3-methoxy-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]-2-(6-oxopiperidin-3-yl)oxybenzonitrile |
|---|---|
| PubChem CID | 118980322 |
| Molecular Formula | C29H32N8O4 |
| Molecular Weight | 556.63 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | 5-[4-[3-methoxy-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]-2-(6-oxopiperidin-3-yl)oxybenzonitrile |
| SMILES | COc1cc(Nc2ncnc(-c3ccc(OC4CCC(=O)NC4)c(C#N)c3)n2)ccc1N1CCN(C2COC2)CC1 |
| InChI | InChI=1S/C29H32N8O4/c1-39-26-13-21(3-5-24(26)37-10-8-36(9-11-37)22-16-40-17-22)34-29-33-18-32-28(35-29)19-2-6-25(20(12-19)14-30)41-23-4-7-27(38)31-15-23/h2-3,5-6,12-13,18,22-23H,4,7-11,15-17H2,1H3,(H,31,38)(H,32,33,34,35) |
| InChIKey | PDFMRDDQEWFBFY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 137.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.63 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|