C34H41FN8O5 — CID 118979934
butyl 4-[2-cyano-4-[4-[3-methoxy-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]phenoxy]-3-fluoropiperidine-1-carboxylate (PubChem CID 118979934) has the molecular formula C34H41FN8O5 and a molecular weight of 660.75 g/mol. Its IUPAC name is butyl 4-[2-cyano-4-[4-[3-methoxy-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]phenoxy]-3-fluoropiperidine-1-carboxylate.
| Compound Name | butyl 4-[2-cyano-4-[4-[3-methoxy-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]phenoxy]-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 118979934 |
| Molecular Formula | C34H41FN8O5 |
| Molecular Weight | 660.75 g/mol |
| Exact Mass | 660.32 |
| IUPAC Name | butyl 4-[2-cyano-4-[4-[3-methoxy-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]phenoxy]-3-fluoropiperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(Oc2ccc(-c3ncnc(Nc4ccc(N5CCN(C6COC6)CC5)c(OC)c4)n3)cc2C#N)C(F)C1 |
| InChI | InChI=1S/C34H41FN8O5/c1-3-4-15-47-34(44)43-10-9-30(27(35)19-43)48-29-8-5-23(16-24(29)18-36)32-37-22-38-33(40-32)39-25-6-7-28(31(17-25)45-2)42-13-11-41(12-14-42)26-20-46-21-26/h5-8,16-17,22,26-27,30H,3-4,9-15,19-21H2,1-2H3,(H,37,38,39,40) |
| InChIKey | FVIKJCDBRIDBAZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.75 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|