C30H34N6O5S — CID 121261896
2-(1,1-dioxothian-4-yl)oxy-5-[4-[3-methoxy-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]pyrimidin-2-yl]benzonitrile (PubChem CID 121261896) has the molecular formula C30H34N6O5S and a molecular weight of 590.71 g/mol. Its IUPAC name is 2-(1,1-dioxothian-4-yl)oxy-5-[4-[3-methoxy-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]pyrimidin-2-yl]benzonitrile.
| Compound Name | 2-(1,1-dioxothian-4-yl)oxy-5-[4-[3-methoxy-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]pyrimidin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 121261896 |
| Molecular Formula | C30H34N6O5S |
| Molecular Weight | 590.71 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | 2-(1,1-dioxothian-4-yl)oxy-5-[4-[3-methoxy-4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]pyrimidin-2-yl]benzonitrile |
| SMILES | COc1cc(Nc2ccnc(-c3ccc(OC4CCS(=O)(=O)CC4)c(C#N)c3)n2)ccc1N1CCN(C2COC2)CC1 |
| InChI | InChI=1S/C30H34N6O5S/c1-39-28-17-23(3-4-26(28)36-12-10-35(11-13-36)24-19-40-20-24)33-29-6-9-32-30(34-29)21-2-5-27(22(16-21)18-31)41-25-7-14-42(37,38)15-8-25/h2-6,9,16-17,24-25H,7-8,10-15,19-20H2,1H3,(H,32,33,34) |
| InChIKey | ZJXNVCWWVHBKPZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 129.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.71 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|