C28H30F2N8O2 — CID 118979028
2-(3,3-difluoropiperidin-4-yl)oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 118979028) has the molecular formula C28H30F2N8O2 and a molecular weight of 548.60 g/mol. Its IUPAC name is 2-(3,3-difluoropiperidin-4-yl)oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-(3,3-difluoropiperidin-4-yl)oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 118979028 |
| Molecular Formula | C28H30F2N8O2 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | 2-(3,3-difluoropiperidin-4-yl)oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | N#Cc1cc(-c2ncnc(Nc3ccc(N4CCN(C5COC5)CC4)cc3)n2)ccc1OC1CCNCC1(F)F |
| InChI | InChI=1S/C28H30F2N8O2/c29-28(30)17-32-8-7-25(28)40-24-6-1-19(13-20(24)14-31)26-33-18-34-27(36-26)35-21-2-4-22(5-3-21)37-9-11-38(12-10-37)23-15-39-16-23/h1-6,13,18,23,25,32H,7-12,15-17H2,(H,33,34,35,36) |
| InChIKey | QIRUIRJJCDYWKQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 111.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|