C27H29FN8O — CID 118979500
2-[(3R)-3-fluoropyrrolidin-1-yl]-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 118979500) has the molecular formula C27H29FN8O and a molecular weight of 500.58 g/mol. Its IUPAC name is 2-[(3R)-3-fluoropyrrolidin-1-yl]-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-[(3R)-3-fluoropyrrolidin-1-yl]-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 118979500 |
| Molecular Formula | C27H29FN8O |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 2-[(3R)-3-fluoropyrrolidin-1-yl]-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | N#Cc1cc(-c2ncnc(Nc3ccc(N4CCN(C5COC5)CC4)cc3)n2)ccc1N1CC[C@@H](F)C1 |
| InChI | InChI=1S/C27H29FN8O/c28-21-7-8-36(15-21)25-6-1-19(13-20(25)14-29)26-30-18-31-27(33-26)32-22-2-4-23(5-3-22)34-9-11-35(12-10-34)24-16-37-17-24/h1-6,13,18,21,24H,7-12,15-17H2,(H,30,31,32,33)/t21-/m1/s1 |
| InChIKey | VIWQXWZKZHSYLR-OAQYLSRUSA-N |
| XLogP | 3.22 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|