C23H22N4O3 — CID 91317630
2-ethynyl-4-[[5-(1-methylpiperidin-4-yl)oxyquinazolin-2-yl]amino]benzoic acid (PubChem CID 91317630) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-ethynyl-4-[[5-(1-methylpiperidin-4-yl)oxyquinazolin-2-yl]amino]benzoic acid.
| Compound Name | 2-ethynyl-4-[[5-(1-methylpiperidin-4-yl)oxyquinazolin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 91317630 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-ethynyl-4-[[5-(1-methylpiperidin-4-yl)oxyquinazolin-2-yl]amino]benzoic acid |
| SMILES | C#Cc1cc(Nc2ncc3c(OC4CCN(C)CC4)cccc3n2)ccc1C(=O)O |
| InChI | InChI=1S/C23H22N4O3/c1-3-15-13-16(7-8-18(15)22(28)29)25-23-24-14-19-20(26-23)5-4-6-21(19)30-17-9-11-27(2)12-10-17/h1,4-8,13-14,17H,9-12H2,2H3,(H,28,29)(H,24,25,26) |
| InChIKey | YHOIGNBRMDQDEJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|