C32H37N5O2 — CID 10196209
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[2-ethynyl-4-[[5-(1-methylpiperidin-4-yl)oxyquinazolin-4-yl]amino]phenyl]methanone (PubChem CID 10196209) has the molecular formula C32H37N5O2 and a molecular weight of 523.68 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[2-ethynyl-4-[[5-(1-methylpiperidin-4-yl)oxyquinazolin-4-yl]amino]phenyl]methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[2-ethynyl-4-[[5-(1-methylpiperidin-4-yl)oxyquinazolin-4-yl]amino]phenyl]methanone |
|---|---|
| PubChem CID | 10196209 |
| Molecular Formula | C32H37N5O2 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[2-ethynyl-4-[[5-(1-methylpiperidin-4-yl)oxyquinazolin-4-yl]amino]phenyl]methanone |
| SMILES | C#Cc1cc(Nc2ncnc3cccc(OC4CCN(C)CC4)c23)ccc1C(=O)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C32H37N5O2/c1-3-22-20-24(13-14-26(22)32(38)37-17-7-9-23-8-4-5-11-28(23)37)35-31-30-27(33-21-34-31)10-6-12-29(30)39-25-15-18-36(2)19-16-25/h1,6,10,12-14,20-21,23,25,28H,4-5,7-9,11,15-19H2,2H3,(H,33,34,35) |
| InChIKey | JTYRPYCCKFYWRC-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|