C23H22ClN5OS2 — CID 68949792
N-[3-chloro-4-(1,3-thiazol-2-ylsulfanyl)phenyl]-5-(1-methylpiperidin-4-yl)oxyquinazolin-4-amine (PubChem CID 68949792) has the molecular formula C23H22ClN5OS2 and a molecular weight of 484.05 g/mol. Its IUPAC name is N-[3-chloro-4-(1,3-thiazol-2-ylsulfanyl)phenyl]-5-(1-methylpiperidin-4-yl)oxyquinazolin-4-amine.
| Compound Name | N-[3-chloro-4-(1,3-thiazol-2-ylsulfanyl)phenyl]-5-(1-methylpiperidin-4-yl)oxyquinazolin-4-amine |
|---|---|
| PubChem CID | 68949792 |
| Molecular Formula | C23H22ClN5OS2 |
| Molecular Weight | 484.05 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | N-[3-chloro-4-(1,3-thiazol-2-ylsulfanyl)phenyl]-5-(1-methylpiperidin-4-yl)oxyquinazolin-4-amine |
| SMILES | CN1CCC(Oc2cccc3ncnc(Nc4ccc(Sc5nccs5)c(Cl)c4)c23)CC1 |
| InChI | InChI=1S/C23H22ClN5OS2/c1-29-10-7-16(8-11-29)30-19-4-2-3-18-21(19)22(27-14-26-18)28-15-5-6-20(17(24)13-15)32-23-25-9-12-31-23/h2-6,9,12-14,16H,7-8,10-11H2,1H3,(H,26,27,28) |
| InChIKey | CVCUDLYMERWIRO-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.05 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|