C30H32ClFN4O4 — CID 68885707
N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-7-(2-methoxyethoxy)-5-(1-methylpiperidin-4-yl)oxyquinazolin-4-amine (PubChem CID 68885707) has the molecular formula C30H32ClFN4O4 and a molecular weight of 567.06 g/mol. Its IUPAC name is N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-7-(2-methoxyethoxy)-5-(1-methylpiperidin-4-yl)oxyquinazolin-4-amine.
| Compound Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-7-(2-methoxyethoxy)-5-(1-methylpiperidin-4-yl)oxyquinazolin-4-amine |
|---|---|
| PubChem CID | 68885707 |
| Molecular Formula | C30H32ClFN4O4 |
| Molecular Weight | 567.06 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-7-(2-methoxyethoxy)-5-(1-methylpiperidin-4-yl)oxyquinazolin-4-amine |
| SMILES | COCCOc1cc(OC2CCN(C)CC2)c2c(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)ncnc2c1 |
| InChI | InChI=1S/C30H32ClFN4O4/c1-36-10-8-23(9-11-36)40-28-17-24(38-13-12-37-2)16-26-29(28)30(34-19-33-26)35-22-6-7-27(25(31)15-22)39-18-20-4-3-5-21(32)14-20/h3-7,14-17,19,23H,8-13,18H2,1-2H3,(H,33,34,35) |
| InChIKey | QZCNKEUOKAAXLG-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.06 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|