C27H27BrN4O2 — CID 68885074
N-(3-bromophenyl)-5-(1-methylpiperidin-4-yl)oxy-7-phenylmethoxyquinazolin-4-amine (PubChem CID 68885074) has the molecular formula C27H27BrN4O2 and a molecular weight of 519.44 g/mol. Its IUPAC name is N-(3-bromophenyl)-5-(1-methylpiperidin-4-yl)oxy-7-phenylmethoxyquinazolin-4-amine.
| Compound Name | N-(3-bromophenyl)-5-(1-methylpiperidin-4-yl)oxy-7-phenylmethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 68885074 |
| Molecular Formula | C27H27BrN4O2 |
| Molecular Weight | 519.44 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | N-(3-bromophenyl)-5-(1-methylpiperidin-4-yl)oxy-7-phenylmethoxyquinazolin-4-amine |
| SMILES | CN1CCC(Oc2cc(OCc3ccccc3)cc3ncnc(Nc4cccc(Br)c4)c23)CC1 |
| InChI | InChI=1S/C27H27BrN4O2/c1-32-12-10-22(11-13-32)34-25-16-23(33-17-19-6-3-2-4-7-19)15-24-26(25)27(30-18-29-24)31-21-9-5-8-20(28)14-21/h2-9,14-16,18,22H,10-13,17H2,1H3,(H,29,30,31) |
| InChIKey | UAOGZKMHMGIUMZ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.44 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |