C24H30N4O3 — CID 68891341
7-(2-methoxyethoxy)-N-(3-methylphenyl)-5-(1-methylpiperidin-4-yl)oxyquinazolin-4-amine (PubChem CID 68891341) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is 7-(2-methoxyethoxy)-N-(3-methylphenyl)-5-(1-methylpiperidin-4-yl)oxyquinazolin-4-amine.
| Compound Name | 7-(2-methoxyethoxy)-N-(3-methylphenyl)-5-(1-methylpiperidin-4-yl)oxyquinazolin-4-amine |
|---|---|
| PubChem CID | 68891341 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 7-(2-methoxyethoxy)-N-(3-methylphenyl)-5-(1-methylpiperidin-4-yl)oxyquinazolin-4-amine |
| SMILES | COCCOc1cc(OC2CCN(C)CC2)c2c(Nc3cccc(C)c3)ncnc2c1 |
| InChI | InChI=1S/C24H30N4O3/c1-17-5-4-6-18(13-17)27-24-23-21(25-16-26-24)14-20(30-12-11-29-3)15-22(23)31-19-7-9-28(2)10-8-19/h4-6,13-16,19H,7-12H2,1-3H3,(H,25,26,27) |
| InChIKey | JAYUNNAVXHBKGT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|