C22H26Cl2N4O4 — CID 22140758
N-(3H-1,2-benzodioxol-7-yl)-7-methoxy-5-(1-methylpiperidin-4-yl)oxyquinazolin-4-amine;dihydrochloride (PubChem CID 22140758) has the molecular formula C22H26Cl2N4O4 and a molecular weight of 481.38 g/mol. Its IUPAC name is N-(3H-1,2-benzodioxol-7-yl)-7-methoxy-5-(1-methylpiperidin-4-yl)oxyquinazolin-4-amine;dihydrochloride.
| Compound Name | N-(3H-1,2-benzodioxol-7-yl)-7-methoxy-5-(1-methylpiperidin-4-yl)oxyquinazolin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 22140758 |
| Molecular Formula | C22H26Cl2N4O4 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | N-(3H-1,2-benzodioxol-7-yl)-7-methoxy-5-(1-methylpiperidin-4-yl)oxyquinazolin-4-amine;dihydrochloride |
| SMILES | COc1cc(OC2CCN(C)CC2)c2c(Nc3cccc4c3OOC4)ncnc2c1.Cl.Cl |
| InChI | InChI=1S/C22H24N4O4.2ClH/c1-26-8-6-15(7-9-26)29-19-11-16(27-2)10-18-20(19)22(24-13-23-18)25-17-5-3-4-14-12-28-30-21(14)17;;/h3-5,10-11,13,15H,6-9,12H2,1-2H3,(H,23,24,25);2*1H |
| InChIKey | RLPNXCVQRDIIJM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|