C29H33N5O2 — CID 86596659
azepan-1-yl-[2-ethynyl-4-[[5-(1-methylpiperidin-4-yl)oxyquinazolin-4-yl]amino]phenyl]methanone (PubChem CID 86596659) has the molecular formula C29H33N5O2 and a molecular weight of 483.62 g/mol. Its IUPAC name is azepan-1-yl-[2-ethynyl-4-[[5-(1-methylpiperidin-4-yl)oxyquinazolin-4-yl]amino]phenyl]methanone.
| Compound Name | azepan-1-yl-[2-ethynyl-4-[[5-(1-methylpiperidin-4-yl)oxyquinazolin-4-yl]amino]phenyl]methanone |
|---|---|
| PubChem CID | 86596659 |
| Molecular Formula | C29H33N5O2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | azepan-1-yl-[2-ethynyl-4-[[5-(1-methylpiperidin-4-yl)oxyquinazolin-4-yl]amino]phenyl]methanone |
| SMILES | C#Cc1cc(Nc2ncnc3cccc(OC4CCN(C)CC4)c23)ccc1C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C29H33N5O2/c1-3-21-19-22(11-12-24(21)29(35)34-15-6-4-5-7-16-34)32-28-27-25(30-20-31-28)9-8-10-26(27)36-23-13-17-33(2)18-14-23/h1,8-12,19-20,23H,4-7,13-18H2,2H3,(H,30,31,32) |
| InChIKey | FWPRXWUYGAXGKH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|