C23H33N5O3 — CID 165385710
4-[[4-(aminomethyl)cyclohexyl]methoxy]-5-methoxy-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine (PubChem CID 165385710) has the molecular formula C23H33N5O3 and a molecular weight of 427.55 g/mol. Its IUPAC name is 4-[[4-(aminomethyl)cyclohexyl]methoxy]-5-methoxy-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine.
| Compound Name | 4-[[4-(aminomethyl)cyclohexyl]methoxy]-5-methoxy-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 165385710 |
| Molecular Formula | C23H33N5O3 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 4-[[4-(aminomethyl)cyclohexyl]methoxy]-5-methoxy-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine |
| SMILES | COc1cnc(Nc2ccc(N3CCOCC3)cc2)nc1OCC1CCC(CN)CC1 |
| InChI | InChI=1S/C23H33N5O3/c1-29-21-15-25-23(27-22(21)31-16-18-4-2-17(14-24)3-5-18)26-19-6-8-20(9-7-19)28-10-12-30-13-11-28/h6-9,15,17-18H,2-5,10-14,16,24H2,1H3,(H,25,26,27) |
| InChIKey | ZUBXKJXXTIANFT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 94.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|