C22H26F4N4O2 — CID 175805445
5-fluoro-N-(4-morpholin-4-ylphenyl)-4-[[4-(trifluoromethyl)cyclohexyl]methoxy]pyrimidin-2-amine (PubChem CID 175805445) has the molecular formula C22H26F4N4O2 and a molecular weight of 454.47 g/mol. Its IUPAC name is 5-fluoro-N-(4-morpholin-4-ylphenyl)-4-[[4-(trifluoromethyl)cyclohexyl]methoxy]pyrimidin-2-amine.
| Compound Name | 5-fluoro-N-(4-morpholin-4-ylphenyl)-4-[[4-(trifluoromethyl)cyclohexyl]methoxy]pyrimidin-2-amine |
|---|---|
| PubChem CID | 175805445 |
| Molecular Formula | C22H26F4N4O2 |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 5-fluoro-N-(4-morpholin-4-ylphenyl)-4-[[4-(trifluoromethyl)cyclohexyl]methoxy]pyrimidin-2-amine |
| SMILES | Fc1cnc(Nc2ccc(N3CCOCC3)cc2)nc1OCC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H26F4N4O2/c23-19-13-27-21(28-17-5-7-18(8-6-17)30-9-11-31-12-10-30)29-20(19)32-14-15-1-3-16(4-2-15)22(24,25)26/h5-8,13,15-16H,1-4,9-12,14H2,(H,27,28,29) |
| InChIKey | GGKGAFBKIAQILK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|