C18H23FN6O2 — CID 165385519
4-[[5-fluoro-2-[[1-(2-isocyanopropan-2-yl)pyrazol-4-yl]amino]pyrimidin-4-yl]oxymethyl]cyclohexan-1-ol (PubChem CID 165385519) has the molecular formula C18H23FN6O2 and a molecular weight of 374.42 g/mol. Its IUPAC name is 4-[[5-fluoro-2-[[1-(2-isocyanopropan-2-yl)pyrazol-4-yl]amino]pyrimidin-4-yl]oxymethyl]cyclohexan-1-ol.
| Compound Name | 4-[[5-fluoro-2-[[1-(2-isocyanopropan-2-yl)pyrazol-4-yl]amino]pyrimidin-4-yl]oxymethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 165385519 |
| Molecular Formula | C18H23FN6O2 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 4-[[5-fluoro-2-[[1-(2-isocyanopropan-2-yl)pyrazol-4-yl]amino]pyrimidin-4-yl]oxymethyl]cyclohexan-1-ol |
| SMILES | [C-]#[N+]C(C)(C)n1cc(Nc2ncc(F)c(OCC3CCC(O)CC3)n2)cn1 |
| InChI | InChI=1S/C18H23FN6O2/c1-18(2,20-3)25-10-13(8-22-25)23-17-21-9-15(19)16(24-17)27-11-12-4-6-14(26)7-5-12/h8-10,12,14,26H,4-7,11H2,1-2H3,(H,21,23,24) |
| InChIKey | AFBFKUQGADDROC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 89.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|