C17H24FN5O2 — CID 175805479
4-(cyclohexylmethoxy)-5-fluoro-N-[1-(2-methoxyethyl)pyrazol-4-yl]pyrimidin-2-amine (PubChem CID 175805479) has the molecular formula C17H24FN5O2 and a molecular weight of 349.41 g/mol. Its IUPAC name is 4-(cyclohexylmethoxy)-5-fluoro-N-[1-(2-methoxyethyl)pyrazol-4-yl]pyrimidin-2-amine.
| Compound Name | 4-(cyclohexylmethoxy)-5-fluoro-N-[1-(2-methoxyethyl)pyrazol-4-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 175805479 |
| Molecular Formula | C17H24FN5O2 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 4-(cyclohexylmethoxy)-5-fluoro-N-[1-(2-methoxyethyl)pyrazol-4-yl]pyrimidin-2-amine |
| SMILES | COCCn1cc(Nc2ncc(F)c(OCC3CCCCC3)n2)cn1 |
| InChI | InChI=1S/C17H24FN5O2/c1-24-8-7-23-11-14(9-20-23)21-17-19-10-15(18)16(22-17)25-12-13-5-3-2-4-6-13/h9-11,13H,2-8,12H2,1H3,(H,19,21,22) |
| InChIKey | DKKLMIWFOWSFOU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |