C21H29FN6O2 — CID 165385610
4-[(4-ethoxycyclohexyl)methoxy]-5-fluoro-N-[1-(2-isocyanopropan-2-yl)-3-methylpyrazol-4-yl]pyrimidin-2-amine (PubChem CID 165385610) has the molecular formula C21H29FN6O2 and a molecular weight of 416.50 g/mol. Its IUPAC name is 4-[(4-ethoxycyclohexyl)methoxy]-5-fluoro-N-[1-(2-isocyanopropan-2-yl)-3-methylpyrazol-4-yl]pyrimidin-2-amine.
| Compound Name | 4-[(4-ethoxycyclohexyl)methoxy]-5-fluoro-N-[1-(2-isocyanopropan-2-yl)-3-methylpyrazol-4-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 165385610 |
| Molecular Formula | C21H29FN6O2 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 4-[(4-ethoxycyclohexyl)methoxy]-5-fluoro-N-[1-(2-isocyanopropan-2-yl)-3-methylpyrazol-4-yl]pyrimidin-2-amine |
| SMILES | [C-]#[N+]C(C)(C)n1cc(Nc2ncc(F)c(OCC3CCC(OCC)CC3)n2)c(C)n1 |
| InChI | InChI=1S/C21H29FN6O2/c1-6-29-16-9-7-15(8-10-16)13-30-19-17(22)11-24-20(26-19)25-18-12-28(27-14(18)2)21(3,4)23-5/h11-12,15-16H,6-10,13H2,1-4H3,(H,24,25,26) |
| InChIKey | YYOPRMHJYMDMBZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|