C24H34N4O3 — CID 165385737
2-[4-[[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]oxymethyl]cyclohexyl]propan-2-ol (PubChem CID 165385737) has the molecular formula C24H34N4O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is 2-[4-[[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]oxymethyl]cyclohexyl]propan-2-ol.
| Compound Name | 2-[4-[[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]oxymethyl]cyclohexyl]propan-2-ol |
|---|---|
| PubChem CID | 165385737 |
| Molecular Formula | C24H34N4O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | 2-[4-[[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]oxymethyl]cyclohexyl]propan-2-ol |
| SMILES | CC(C)(O)C1CCC(COc2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)CC1 |
| InChI | InChI=1S/C24H34N4O3/c1-24(2,29)19-5-3-18(4-6-19)17-31-22-11-12-25-23(27-22)26-20-7-9-21(10-8-20)28-13-15-30-16-14-28/h7-12,18-19,29H,3-6,13-17H2,1-2H3,(H,25,26,27) |
| InChIKey | GJIXKJCUFOMFMC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|