C23H30F4N6O2 — CID 167346795
5-fluoro-N-(4-morpholin-4-ylphenyl)-4-[[1-(1,1,1-trifluoropropan-2-ylamino)piperidin-4-yl]methoxy]pyrimidin-2-amine (PubChem CID 167346795) has the molecular formula C23H30F4N6O2 and a molecular weight of 498.53 g/mol. Its IUPAC name is 5-fluoro-N-(4-morpholin-4-ylphenyl)-4-[[1-(1,1,1-trifluoropropan-2-ylamino)piperidin-4-yl]methoxy]pyrimidin-2-amine.
| Compound Name | 5-fluoro-N-(4-morpholin-4-ylphenyl)-4-[[1-(1,1,1-trifluoropropan-2-ylamino)piperidin-4-yl]methoxy]pyrimidin-2-amine |
|---|---|
| PubChem CID | 167346795 |
| Molecular Formula | C23H30F4N6O2 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 5-fluoro-N-(4-morpholin-4-ylphenyl)-4-[[1-(1,1,1-trifluoropropan-2-ylamino)piperidin-4-yl]methoxy]pyrimidin-2-amine |
| SMILES | CC(NN1CCC(COc2nc(Nc3ccc(N4CCOCC4)cc3)ncc2F)CC1)C(F)(F)F |
| InChI | InChI=1S/C23H30F4N6O2/c1-16(23(25,26)27)31-33-8-6-17(7-9-33)15-35-21-20(24)14-28-22(30-21)29-18-2-4-19(5-3-18)32-10-12-34-13-11-32/h2-5,14,16-17,31H,6-13,15H2,1H3,(H,28,29,30) |
| InChIKey | JNXOQUQSFKVDLG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|