C30H31ClN4O3 — CID 147209298
5-[2-(4-chlorophenyl)ethyl]-4-(2-methoxy-4-methylphenoxy)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine (PubChem CID 147209298) has the molecular formula C30H31ClN4O3 and a molecular weight of 531.06 g/mol. Its IUPAC name is 5-[2-(4-chlorophenyl)ethyl]-4-(2-methoxy-4-methylphenoxy)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine.
| Compound Name | 5-[2-(4-chlorophenyl)ethyl]-4-(2-methoxy-4-methylphenoxy)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 147209298 |
| Molecular Formula | C30H31ClN4O3 |
| Molecular Weight | 531.06 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 5-[2-(4-chlorophenyl)ethyl]-4-(2-methoxy-4-methylphenoxy)-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine |
| SMILES | COc1cc(C)ccc1Oc1nc(Nc2ccc(N3CCOCC3)cc2)ncc1CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H31ClN4O3/c1-21-3-14-27(28(19-21)36-2)38-29-23(7-4-22-5-8-24(31)9-6-22)20-32-30(34-29)33-25-10-12-26(13-11-25)35-15-17-37-18-16-35/h3,5-6,8-14,19-20H,4,7,15-18H2,1-2H3,(H,32,33,34) |
| InChIKey | CEWMUNQZHHYIJJ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.06 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|