C15H17ClN4O2 — CID 141139716
5-chloro-N-(2-methoxy-5-morpholin-4-ylphenyl)pyrimidin-2-amine (PubChem CID 141139716) has the molecular formula C15H17ClN4O2 and a molecular weight of 320.78 g/mol. Its IUPAC name is 5-chloro-N-(2-methoxy-5-morpholin-4-ylphenyl)pyrimidin-2-amine.
| Compound Name | 5-chloro-N-(2-methoxy-5-morpholin-4-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 141139716 |
| Molecular Formula | C15H17ClN4O2 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 5-chloro-N-(2-methoxy-5-morpholin-4-ylphenyl)pyrimidin-2-amine |
| SMILES | COc1ccc(N2CCOCC2)cc1Nc1ncc(Cl)cn1 |
| InChI | InChI=1S/C15H17ClN4O2/c1-21-14-3-2-12(20-4-6-22-7-5-20)8-13(14)19-15-17-9-11(16)10-18-15/h2-3,8-10H,4-7H2,1H3,(H,17,18,19) |
| InChIKey | IQCHFDRFIXSRBE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|