C19H26N6O3 — CID 7589328
N-(2-methoxy-5-methylphenyl)-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 7589328) has the molecular formula C19H26N6O3 and a molecular weight of 386.46 g/mol. Its IUPAC name is N-(2-methoxy-5-methylphenyl)-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | N-(2-methoxy-5-methylphenyl)-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 7589328 |
| Molecular Formula | C19H26N6O3 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-(2-methoxy-5-methylphenyl)-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(C)cc1Nc1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C19H26N6O3/c1-14-3-4-16(26-2)15(13-14)20-17-21-18(24-5-9-27-10-6-24)23-19(22-17)25-7-11-28-12-8-25/h3-4,13H,5-12H2,1-2H3,(H,20,21,22,23) |
| InChIKey | TYDZDMDQAWLXNF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 84.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |